CAS 1443-10-3 is the registry number for CDK2-IN-51. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,6,11-trimethyl-13-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene (CAS 1443-10-3) is a chemical compound with the molecular formula C18H16N4 and a molecular weight of 288.3 g/mol. IUPAC name: 4,6,11-trimethyl-13-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene. InChIKey: CIVYGVCDHVJCCJ-UHFFFAOYSA-N.
| Molecular formula | C18H16N4 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4,6,11-trimethyl-13-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene |
| InChIKey | CIVYGVCDHVJCCJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C3C(=CC(=NC3=NN12)C)C4=CC=CC=C4)C |
Computed by PubChem (NCBI)