CAS 1294003-39-6 is the registry number for 5-Chloro-4-fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1294003-39-6) is a chemical compound with the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. IUPAC name: 5-chloro-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: ZLFZKGBTMBGWEL-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2FNO |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 5-chloro-4-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | ZLFZKGBTMBGWEL-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=CC(=C2F)Cl)N.Cl |
Computed by PubChem (NCBI)