Products 1980085-72-0
CAS 1980085-72-0 is the registry number for 3-Chloro-2-fluorophenacylamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-1-(3-chloro-2-fluorophenyl)ethanone;hydrochloride (CAS 1980085-72-0) is a chemical compound with the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. IUPAC name: 2-amino-1-(3-chloro-2-fluorophenyl)ethanone;hydrochloride. InChIKey: QSZFNAWLDVIZRL-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2FNO |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 2-amino-1-(3-chloro-2-fluorophenyl)ethanone;hydrochloride |
| InChIKey | QSZFNAWLDVIZRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C(=O)CN.Cl |
Computed by PubChem (NCBI)