CAS 2044722-86-1 appears in our catalog under these names: 2-Amino-1-(2-chloro-4-fluorophenyl)ethan-1-one hydrochloride, 2-Amino-1-(2-chloro-4-fluorophenyl)ethan-1-one hydrochloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 0,5g, 5g, 250mg, 10g, 1g.
2-amino-1-(2-chloro-4-fluorophenyl)ethanone;hydrochloride (CAS 2044722-86-1) is a chemical compound with the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. IUPAC name: 2-amino-1-(2-chloro-4-fluorophenyl)ethanone;hydrochloride. InChIKey: YYMKXNCXOFRIRF-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2FNO |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 2-amino-1-(2-chloro-4-fluorophenyl)ethanone;hydrochloride |
| InChIKey | YYMKXNCXOFRIRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C(=O)CN.Cl |
Computed by PubChem (NCBI)