CAS 1909317-00-5 appears in our catalog under these names: 2-Amino-1-(2-chloro-6-fluorophenyl)ethan-1-one hydrochloride, 95%, 2-Amino-1-(2-chloro-6-fluorophenyl)ethan-1-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
2-amino-1-(2-chloro-6-fluorophenyl)ethanone;hydrochloride (CAS 1909317-00-5) is a chemical compound with the molecular formula C8H8Cl2FNO and a molecular weight of 224.06 g/mol. IUPAC name: 2-amino-1-(2-chloro-6-fluorophenyl)ethanone;hydrochloride. InChIKey: OCZAXDXZWCUNCF-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2FNO |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 2-amino-1-(2-chloro-6-fluorophenyl)ethanone;hydrochloride |
| InChIKey | OCZAXDXZWCUNCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)CN)F.Cl |
Computed by PubChem (NCBI)