Products 1294497-37-2
CAS 1294497-37-2 is the registry number for 3-(aminomethyl)-2,6-dichlorobenzoic acid hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
3-(aminomethyl)-2,6-dichlorobenzoic acid;hydrochloride (CAS 1294497-37-2) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 3-(aminomethyl)-2,6-dichlorobenzoic acid;hydrochloride. InChIKey: PBHVMHWSGIUDQH-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO2 |
|---|---|
| Molecular weight | 256.5 g/mol |
| IUPAC name | 3-(aminomethyl)-2,6-dichlorobenzoic acid;hydrochloride |
| InChIKey | PBHVMHWSGIUDQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN)Cl)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)