CAS 129488-74-0 appears in our catalog under these names: 4-(1-Cyano-1-methylethyl)benzoic acid, 95%, 4–(2–Cyanopropan–2–yl)benzoic acid, 4-(2-Cyano-2-propyl)benzoic Acid, 4-(1-cyano-1-methylethyl)benzoic acid, 98%, 98%, 4-(2-Cyanopropan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.
4-(2-cyanopropan-2-yl)benzoic acid (CAS 129488-74-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4-(2-cyanopropan-2-yl)benzoic acid. InChIKey: MAVFXLXXHAMJTB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-(2-cyanopropan-2-yl)benzoic acid |
| InChIKey | MAVFXLXXHAMJTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)