CAS 1296194-31-4 appears in our catalog under these names: 6-Methyl-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 95%, 95%, 6-Methyl-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (CAS 1296194-31-4) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 6-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one. InChIKey: YKLXJJCKPFOCKL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| InChIKey | YKLXJJCKPFOCKL-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=O)CCN2 |
Computed by PubChem (NCBI)