Products 129623-61-6
CAS 129623-61-6 appears in our catalog under these names: 4–(4–Fluorophenoxy)benzoic acid, 4-(4-Fluorophenoxy)benzoic acid 95%, 4-(4-FLUOROPHENOXY)BENZOIC ACID, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g.
4-(4-fluorophenoxy)benzoic acid (CAS 129623-61-6) is a chemical compound with the molecular formula C13H9FO3 and a molecular weight of 232.21 g/mol. IUPAC name: 4-(4-fluorophenoxy)benzoic acid. InChIKey: YYKALFXKRWCSLY-UHFFFAOYSA-N.
| Molecular formula | C13H9FO3 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 4-(4-fluorophenoxy)benzoic acid |
| InChIKey | YYKALFXKRWCSLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)