CAS 129655-38-5 appears in our catalog under these names: 5-(Ethoxycarbonyl)-1H-indole-2-carboxylic acid, 95%, 95%, 5-(Ethoxycarbonyl)-1H-indole-2-carboxylic acid, 97%, 5-(Ethoxycarbonyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
5-ethoxycarbonyl-1H-indole-2-carboxylic acid (CAS 129655-38-5) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 5-ethoxycarbonyl-1H-indole-2-carboxylic acid. InChIKey: KXIJQVTXEFFFIE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 5-ethoxycarbonyl-1H-indole-2-carboxylic acid |
| InChIKey | KXIJQVTXEFFFIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)