CAS 129822-39-5 is the registry number for tert-Butyl N-(3-chloro-2-methylphenyl)carbamate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g, 100g.
Tert-butyl N-(3-chloro-2-methylphenyl)carbamate (CAS 129822-39-5) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: tert-butyl N-(3-chloro-2-methylphenyl)carbamate. InChIKey: FUFRZWSIYKXLRV-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | tert-butyl N-(3-chloro-2-methylphenyl)carbamate |
| InChIKey | FUFRZWSIYKXLRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)