CAS 129872-82-8 is the registry number for 2,4-Dichloro-5-ethyl-5h-pyrrolo[3,2-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 100mg, 1g.
2,4-dichloro-5-ethylpyrrolo[3,2-d]pyrimidine (CAS 129872-82-8) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: 2,4-dichloro-5-ethylpyrrolo[3,2-d]pyrimidine. InChIKey: OMEALJXAHAGMIE-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 2,4-dichloro-5-ethylpyrrolo[3,2-d]pyrimidine |
| InChIKey | OMEALJXAHAGMIE-UHFFFAOYSA-N |
| SMILES | CCN1C=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)