CAS 2769718-16-1 is the registry number for 4,6-Dichloro-1,2-dimethyl-1H-imidazo[4,5-c]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine (CAS 2769718-16-1) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: 4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine. InChIKey: YCAFVTDCYUYHSF-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine |
| InChIKey | YCAFVTDCYUYHSF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N=C(C=C2N1C)Cl)Cl |
Computed by PubChem (NCBI)