CAS 579486-61-6 appears in our catalog under these names: 4,6-Dichloro-2-ethyl-1H-imidazo(4,5-c)pyridine, 97%, 4,6-Dichloro-2-ethyl-1H-imidazo(4,5-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,6-dichloro-2-ethyl-1H-imidazo[4,5-c]pyridine (CAS 579486-61-6) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: 4,6-dichloro-2-ethyl-1H-imidazo[4,5-c]pyridine. InChIKey: SAKVPOFFPTVSQH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 4,6-dichloro-2-ethyl-1H-imidazo[4,5-c]pyridine |
| InChIKey | SAKVPOFFPTVSQH-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(N=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)