CAS 1638759-50-8 is the registry number for 2,4-Dichloro-6,7-dimethyl-7H-pyrrolo[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6,7-dimethylpyrrolo[2,3-d]pyrimidine (CAS 1638759-50-8) is a chemical compound with the molecular formula C8H7Cl2N3 and a molecular weight of 216.06 g/mol. IUPAC name: 2,4-dichloro-6,7-dimethylpyrrolo[2,3-d]pyrimidine. InChIKey: QGQVAERZNQBYKF-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2N3 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | 2,4-dichloro-6,7-dimethylpyrrolo[2,3-d]pyrimidine |
| InChIKey | QGQVAERZNQBYKF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)