CAS 130007-89-5 is the registry number for (S)-1-(Chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-ol hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-ol;hydrochloride (CAS 130007-89-5) is a chemical compound with the molecular formula C13H13Cl2NO and a molecular weight of 270.15 g/mol. IUPAC name: (1S)-1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-ol;hydrochloride. InChIKey: LKWGSJUHAQAJGJ-DDWIOCJRSA-N.
| Molecular formula | C13H13Cl2NO |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | (1S)-1-(chloromethyl)-2,3-dihydro-1H-benzo[e]indol-5-ol;hydrochloride |
| InChIKey | LKWGSJUHAQAJGJ-DDWIOCJRSA-N |
| SMILES | C1[C@H](C2=C(N1)C=C(C3=CC=CC=C32)O)CCl.Cl |
Computed by PubChem (NCBI)