CAS 262862-71-5 appears in our catalog under these names: (4-(4-Chlorophenoxy)phenyl)methanamine hydrochloride 95%, (4-(4-Chlorophenoxy)phenyl)methanamine hydrochloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[4-(4-chlorophenoxy)phenyl]methanamine;hydrochloride (CAS 262862-71-5) is a chemical compound with the molecular formula C13H13Cl2NO and a molecular weight of 270.15 g/mol. IUPAC name: [4-(4-chlorophenoxy)phenyl]methanamine;hydrochloride. InChIKey: BFQVELFTOFIOEB-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | [4-(4-chlorophenoxy)phenyl]methanamine;hydrochloride |
| InChIKey | BFQVELFTOFIOEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)OC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)