Products 1431965-79-5
CAS 1431965-79-5 is the registry number for 3-((2-Chlorophenoxy)methyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-[(2-chlorophenoxy)methyl]aniline;hydrochloride (CAS 1431965-79-5) is a chemical compound with the molecular formula C13H13Cl2NO and a molecular weight of 270.15 g/mol. IUPAC name: 3-[(2-chlorophenoxy)methyl]aniline;hydrochloride. InChIKey: YKBDQMLXMFGOMM-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 3-[(2-chlorophenoxy)methyl]aniline;hydrochloride |
| InChIKey | YKBDQMLXMFGOMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC(=CC=C2)N)Cl.Cl |
Computed by PubChem (NCBI)