CAS 1352318-69-4 is the registry number for 3-(4-Chloro-2-methoxyphenyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-chloro-2-methoxyphenyl)aniline;hydrochloride (CAS 1352318-69-4) is a chemical compound with the molecular formula C13H13Cl2NO and a molecular weight of 270.15 g/mol. IUPAC name: 3-(4-chloro-2-methoxyphenyl)aniline;hydrochloride. InChIKey: YHLKEZUUFAPEKX-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 3-(4-chloro-2-methoxyphenyl)aniline;hydrochloride |
| InChIKey | YHLKEZUUFAPEKX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)