CAS 130008-79-6 is the registry number for rel-4-((2R,3R)-4-(1,3-Benzodioxol-5-yl)-2,3-dimethylbutyl)-2-methoxyphenol. Offered by: TRC. Available pack sizes: 100mg.
4-[(2R,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol (CAS 130008-79-6) is a chemical compound with the molecular formula C20H24O4 and a molecular weight of 328.4 g/mol. IUPAC name: 4-[(2R,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol. InChIKey: QDDILOVMGWUNGD-ZIAGYGMSSA-N.
| Molecular formula | C20H24O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 4-[(2R,3R)-4-(1,3-benzodioxol-5-yl)-2,3-dimethylbutyl]-2-methoxyphenol |
| InChIKey | QDDILOVMGWUNGD-ZIAGYGMSSA-N |
| SMILES | C[C@H](CC1=CC2=C(C=C1)OCO2)[C@H](C)CC3=CC(=C(C=C3)O)OC |
Computed by PubChem (NCBI)