CAS 130035-55-1 is the registry number for 4-(4-Methoxyphenoxy)-6-methyl-2-pyrimidinamine. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-methoxyphenoxy)-6-methylpyrimidin-2-amine (CAS 130035-55-1) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 4-(4-methoxyphenoxy)-6-methylpyrimidin-2-amine. InChIKey: SLTWEZDKMKRHHE-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-(4-methoxyphenoxy)-6-methylpyrimidin-2-amine |
| InChIKey | SLTWEZDKMKRHHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)OC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)