Products 82855-64-9
CAS 82855-64-9 is the registry number for N4,N4-Dimethylarabinocytidine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one (CAS 82855-64-9) is a chemical compound with the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. IUPAC name: 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one. InChIKey: GFCDNWCHLZESES-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O5 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(dimethylamino)pyrimidin-2-one |
| InChIKey | GFCDNWCHLZESES-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=O)N(C=C1)C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)