Products 1301147-68-1
CAS 1301147-68-1 is the registry number for 1-Bromo-2,5-dichloro-4-(methoxymethoxy)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-2,5-dichloro-4-(methoxymethoxy)benzene (CAS 1301147-68-1) is a chemical compound with the molecular formula C8H7BrCl2O2 and a molecular weight of 285.95 g/mol. IUPAC name: 1-bromo-2,5-dichloro-4-(methoxymethoxy)benzene. InChIKey: ANQOGPSFOCFUIP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O2 |
|---|---|
| Molecular weight | 285.95 g/mol |
| IUPAC name | 1-bromo-2,5-dichloro-4-(methoxymethoxy)benzene |
| InChIKey | ANQOGPSFOCFUIP-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)