CAS 1803562-26-6 appears in our catalog under these names: 3-Bromo-2,4-dichloro-1,5-dimethoxybenzene, 95%, 3-Bromo-2,4-dichloro-1,5-dimethoxybenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg, 1000mg.
3-bromo-2,4-dichloro-1,5-dimethoxybenzene (CAS 1803562-26-6) is a chemical compound with the molecular formula C8H7BrCl2O2 and a molecular weight of 285.95 g/mol. IUPAC name: 3-bromo-2,4-dichloro-1,5-dimethoxybenzene. InChIKey: JWWIYVNGLBZQDG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O2 |
|---|---|
| Molecular weight | 285.95 g/mol |
| IUPAC name | 3-bromo-2,4-dichloro-1,5-dimethoxybenzene |
| InChIKey | JWWIYVNGLBZQDG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)Br)Cl)OC |
Computed by PubChem (NCBI)