CAS 70044-35-8 is the registry number for 2-(4-Bromo-2,6-dichlorophenoxy)ethan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-2,6-dichlorophenoxy)ethanol (CAS 70044-35-8) is a chemical compound with the molecular formula C8H7BrCl2O2 and a molecular weight of 285.95 g/mol. IUPAC name: 2-(4-bromo-2,6-dichlorophenoxy)ethanol. InChIKey: NKDRAHQDMUZGLZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O2 |
|---|---|
| Molecular weight | 285.95 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dichlorophenoxy)ethanol |
| InChIKey | NKDRAHQDMUZGLZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCCO)Cl)Br |
Computed by PubChem (NCBI)