Products 2918872-57-6
CAS 2918872-57-6 is the registry number for 1-Bromo-2,4-dichloro-5-(methoxymethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2,4-dichloro-5-(methoxymethoxy)benzene (CAS 2918872-57-6) is a chemical compound with the molecular formula C8H7BrCl2O2 and a molecular weight of 285.95 g/mol. IUPAC name: 1-bromo-2,4-dichloro-5-(methoxymethoxy)benzene. InChIKey: PCADXWGRSQVREX-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O2 |
|---|---|
| Molecular weight | 285.95 g/mol |
| IUPAC name | 1-bromo-2,4-dichloro-5-(methoxymethoxy)benzene |
| InChIKey | PCADXWGRSQVREX-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)