CAS 130137-40-5 appears in our catalog under these names: 7-Amino-2,4-dimethyl-2h-1,4-benzoxazin-3(4h)-one, 95%, 7–Amino–2,4–dimethyl–2H–1,4–benzoxazin–3(4H)–one, 7-Amino-2,4-dimethyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 98%, 98%, 7-amino-2,4-dimethyl-2H-1,4-benzoxazin-3(4H)-one, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 100mg.
7-amino-2,4-dimethyl-1,4-benzoxazin-3-one (CAS 130137-40-5) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 7-amino-2,4-dimethyl-1,4-benzoxazin-3-one. InChIKey: OIQGECPSMWFOCC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 7-amino-2,4-dimethyl-1,4-benzoxazin-3-one |
| InChIKey | OIQGECPSMWFOCC-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C2=C(O1)C=C(C=C2)N)C |
Computed by PubChem (NCBI)