CAS 130155-41-8 is the registry number for Rivaroxaban Impurity 134. Offered by: Chemat Brand. Available pack sizes: on request.
2-(oxiran-2-ylmethylcarbamoyl)benzoic acid (CAS 130155-41-8) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 2-(oxiran-2-ylmethylcarbamoyl)benzoic acid. InChIKey: RNZSIOFMOSJLCN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-(oxiran-2-ylmethylcarbamoyl)benzoic acid |
| InChIKey | RNZSIOFMOSJLCN-UHFFFAOYSA-N |
| SMILES | C1C(O1)CNC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)