CAS 130160-97-3 is the registry number for Amlodipine Impurity 61. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 130160-97-3) is a chemical compound with the molecular formula C17H16ClNO4 and a molecular weight of 333.8 g/mol. IUPAC name: dimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: FKJDXUHUOIAWJI-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO4 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | dimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | FKJDXUHUOIAWJI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CC=C2Cl)C(=O)OC |
Computed by PubChem (NCBI)