Products 130160-97-3

CAS 130160-97-3 is the registry number for Amlodipine Impurity 61. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 130160-97-3) is a chemical compound with the molecular formula C17H16ClNO4 and a molecular weight of 333.8 g/mol. IUPAC name: dimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: FKJDXUHUOIAWJI-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16ClNO4
Molecular weight333.8 g/mol
IUPAC namedimethyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
InChIKeyFKJDXUHUOIAWJI-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC=CC=C2Cl)C(=O)OC

Computed by PubChem (NCBI)