Products 331955-29-4

CAS 331955-29-4 is the registry number for 2-(((Benzyloxy)carbonyl)amino)-3-(3-chlorophenyl)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 331955-29-4) is a chemical compound with the molecular formula C17H16ClNO4 and a molecular weight of 333.8 g/mol. IUPAC name: 3-(3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: IWFZOONMJOMOIW-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16ClNO4
Molecular weight333.8 g/mol
IUPAC name3-(3-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid
InChIKeyIWFZOONMJOMOIW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC(CC2=CC(=CC=C2)Cl)C(=O)O

Computed by PubChem (NCBI)