CAS 869478-11-5 appears in our catalog under these names: Olodaterol Impurity 7, Olodaterol Impurity 4, (R)-6-(Benzyloxy)-8-(2-chloro-1-hydroxyethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 10g, 25g.
8-[(1R)-2-chloro-1-hydroxyethyl]-6-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 869478-11-5) is a chemical compound with the molecular formula C17H16ClNO4 and a molecular weight of 333.8 g/mol. IUPAC name: 8-[(1R)-2-chloro-1-hydroxyethyl]-6-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: XEOFGWFROZZMSV-HNNXBMFYSA-N.
| Molecular formula | C17H16ClNO4 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | 8-[(1R)-2-chloro-1-hydroxyethyl]-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | XEOFGWFROZZMSV-HNNXBMFYSA-N |
| SMILES | C1C(=O)NC2=CC(=CC(=C2O1)[C@H](CCl)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)