CAS 1799412-36-4 is the registry number for N-(3-Acetyl-5-(benzyloxy)-2-hydroxyphenyl)-2-chloroacetamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
N-(3-acetyl-2-hydroxy-5-phenylmethoxyphenyl)-2-chloroacetamide (CAS 1799412-36-4) is a chemical compound with the molecular formula C17H16ClNO4 and a molecular weight of 333.8 g/mol. IUPAC name: N-(3-acetyl-2-hydroxy-5-phenylmethoxyphenyl)-2-chloroacetamide. InChIKey: LCDPIAJWSLRZSV-UHFFFAOYSA-N.
| Molecular formula | C17H16ClNO4 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | N-(3-acetyl-2-hydroxy-5-phenylmethoxyphenyl)-2-chloroacetamide |
| InChIKey | LCDPIAJWSLRZSV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)OCC2=CC=CC=C2)NC(=O)CCl)O |
Computed by PubChem (NCBI)