Products 130161-00-1
CAS 130161-00-1 appears in our catalog under these names: Amlodipine Impurity 45, Amlodipine Impurity 62. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-ethyl 5-O-methyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (CAS 130161-00-1) is a chemical compound with the molecular formula C18H18ClNO4 and a molecular weight of 347.8 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate. InChIKey: DZKNREBSUBFVSH-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO4 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 4-(2-chlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| InChIKey | DZKNREBSUBFVSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)OC)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)