Products 134306-44-8

CAS 134306-44-8 is the registry number for methyl 2-{[(benzyloxy)carbonyl]amino}-3-(4-chlorophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate (CAS 134306-44-8) is a chemical compound with the molecular formula C18H18ClNO4 and a molecular weight of 347.8 g/mol. IUPAC name: methyl 3-(4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: YWVXHDOQHLDCIY-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18ClNO4
Molecular weight347.8 g/mol
IUPAC namemethyl 3-(4-chlorophenyl)-2-(phenylmethoxycarbonylamino)propanoate
InChIKeyYWVXHDOQHLDCIY-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC=C(C=C1)Cl)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)