CAS 78131-31-4 appears in our catalog under these names: 4-([(Benzyloxy)carbonyl]amino)-3-(4-chlorophenyl)butanoic acid, 95%, 4-{[(benzyloxy)carbonyl]amino}-3-(4-chlorophenyl)butanoic acid, 98%, 4-([(Benzyloxy)carbonyl]amino)-3-(4-chlorophenyl)butanoic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
3-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)butanoic acid (CAS 78131-31-4) is a chemical compound with the molecular formula C18H18ClNO4 and a molecular weight of 347.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: SFFATUNMKIFTNL-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO4 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-4-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | SFFATUNMKIFTNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(CC(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)