Products 380543-06-6
CAS 380543-06-6 is the registry number for N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methylpropanamide, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methylpropanamide (CAS 380543-06-6) is a chemical compound with the molecular formula C18H18ClNO4 and a molecular weight of 347.8 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methylpropanamide. InChIKey: FJONZIFFQLDHDQ-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO4 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-chlorophenoxy)-2-methylpropanamide |
| InChIKey | FJONZIFFQLDHDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NCC1=CC2=C(C=C1)OCO2)OC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)