CAS 130200-01-0 appears in our catalog under these names: 7-Bromo-2,2-dimethylchroman-4-one, 95%, 7–Bromo–2,2–dimethylchroman–4–one, 7-Bromo-2,2-dimethylchroman-4-one, 7-Bromo-2,2-dimethylchroman-4-one 97%, 7-Bromo-2,2-dimethylchroman-4-one, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
7-bromo-2,2-dimethyl-3H-chromen-4-one (CAS 130200-01-0) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 7-bromo-2,2-dimethyl-3H-chromen-4-one. InChIKey: QCVDUIIUXMKXQC-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 7-bromo-2,2-dimethyl-3H-chromen-4-one |
| InChIKey | QCVDUIIUXMKXQC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)