CAS 130282-66-5 is the registry number for (2R,3R,4S,5S)-5-Hydroxy-1-oxohexane-2,3,4-triyl tribenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol (CAS 130282-66-5) is a chemical compound with the molecular formula C27H30O5 and a molecular weight of 434.5 g/mol. IUPAC name: (3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol. InChIKey: YRAQXZMHYZXWBZ-XXPOFYIKSA-N.
| Molecular formula | C27H30O5 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (3R,4R,5S,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| InChIKey | YRAQXZMHYZXWBZ-XXPOFYIKSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H](C(O1)O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)