Products 20787-20-6

CAS 20787-20-6 is the registry number for Methyl 2,3,4-tri-O-benzyl ribopyranose. Offered by: Biosynth. Available pack sizes: 5g, 2g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-methoxy-3,4,5-tris(phenylmethoxy)oxane (CAS 20787-20-6) is a chemical compound with the molecular formula C27H30O5 and a molecular weight of 434.5 g/mol. IUPAC name: 2-methoxy-3,4,5-tris(phenylmethoxy)oxane. InChIKey: CVWJHEJDZRHTCM-UHFFFAOYSA-N.

Identity
Molecular formulaC27H30O5
Molecular weight434.5 g/mol
IUPAC name2-methoxy-3,4,5-tris(phenylmethoxy)oxane
InChIKeyCVWJHEJDZRHTCM-UHFFFAOYSA-N
SMILESCOC1C(C(C(CO1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4

Computed by PubChem (NCBI)