CAS 156719-47-0 is the registry number for (2S,3R,4S,5S,6R)-3,4,5-Tris(benzyloxy)-6-methyltetrahydro-2H-pyran-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol (CAS 156719-47-0) is a chemical compound with the molecular formula C27H30O5 and a molecular weight of 434.5 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol. InChIKey: YRAQXZMHYZXWBZ-GJVZRYLUSA-N.
| Molecular formula | C27H30O5 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| InChIKey | YRAQXZMHYZXWBZ-GJVZRYLUSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)