CAS 20787-15-9 is the registry number for Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 1g, 250mg, 2g, 500mg, 5g.
(2R,3R,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)oxane (CAS 20787-15-9) is a chemical compound with the molecular formula C27H30O5 and a molecular weight of 434.5 g/mol. IUPAC name: (2R,3R,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)oxane. InChIKey: CVWJHEJDZRHTCM-HVWQDESWSA-N.
| Molecular formula | C27H30O5 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| InChIKey | CVWJHEJDZRHTCM-HVWQDESWSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H](CO1)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)