CAS 130312-02-6 appears in our catalog under these names: 1–Z–3–Pyrrolidinone, 1-Carbobenzoxy-3-pyrrolidone, >98.0%(GC), Benzyl 3-oxopyrrolidine-1-carboxylate 97%, 1-Z-3-PYRROLIDINONE, 96%, 1-N-CBZ-3-PYRROLIDINONE, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 1kg, 50g.
Benzyl 3-oxopyrrolidine-1-carboxylate (CAS 130312-02-6) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: benzyl 3-oxopyrrolidine-1-carboxylate. InChIKey: LMHWEUQNJRXMCD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | benzyl 3-oxopyrrolidine-1-carboxylate |
| InChIKey | LMHWEUQNJRXMCD-UHFFFAOYSA-N |
| SMILES | C1CN(CC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)