CAS 82875-47-6 is the registry number for Ethyl 2-(3,4-dimethoxyphenyl)-4-methylthiazole-5-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate (CAS 82875-47-6) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: ethyl 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: OYDTZYBFGUQOJX-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | ethyl 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | OYDTZYBFGUQOJX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C=C2)OC)OC)C |
Computed by PubChem (NCBI)