CAS 182227-17-4 is the registry number for Beta-Naphthalenesulfonyl-D-valine. Offered by: TRC. Available pack sizes: 100mg, 1g.
(2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanoic acid (CAS 182227-17-4) is a chemical compound with the molecular formula C15H17NO4S and a molecular weight of 307.4 g/mol. IUPAC name: (2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanoic acid. InChIKey: GFCPZHIUZCLSNZ-CQSZACIVSA-N.
| Molecular formula | C15H17NO4S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (2R)-3-methyl-2-(naphthalen-2-ylsulfonylamino)butanoic acid |
| InChIKey | GFCPZHIUZCLSNZ-CQSZACIVSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NS(=O)(=O)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)