Products 49694-62-4
CAS 49694-62-4 appears in our catalog under these names: 5-Deoxy-D-lyxose, 5-Deoxy-L-lyxose. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 100mg.
(2S,3S,4R)-2,3,4-trihydroxypentanal (CAS 49694-62-4) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2S,3S,4R)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-WDCZJNDASA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2S,3S,4R)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-WDCZJNDASA-N |
| SMILES | C[C@H]([C@@H]([C@@H](C=O)O)O)O |
Computed by PubChem (NCBI)