Products 13039-77-5
CAS 13039-77-5 is the registry number for 5-Deoxy-D-xylose. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 200mg.
(2R,3S,4R)-2,3,4-trihydroxypentanal (CAS 13039-77-5) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,3S,4R)-2,3,4-trihydroxypentanal. InChIKey: WDRISBUVHBMJEF-WISUUJSJSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,3S,4R)-2,3,4-trihydroxypentanal |
| InChIKey | WDRISBUVHBMJEF-WISUUJSJSA-N |
| SMILES | C[C@H]([C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)