Products 130403-18-8
CAS 130403-18-8 is the registry number for D3017. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,6-dimethylphenyl)-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide (CAS 130403-18-8) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide. InChIKey: INTCSWFXEXGUFR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-5-(hydroxymethyl)-1,2-oxazole-3-carboxamide |
| InChIKey | INTCSWFXEXGUFR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=NOC(=C2)CO |
Computed by PubChem (NCBI)