Products 130416-43-2
CAS 130416-43-2 appears in our catalog under these names: 2-(3-chloro-4-fluorophenyl)propan-2-amine, 2–(3–chloro–4–fluorophenyl)propan–2–amine hydrochloride. Offered by: Chemat, GLPBio. Available pack sizes: 250mg, 1g, 5g.
2-(3-chloro-4-fluorophenyl)propan-2-amine (CAS 130416-43-2) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)propan-2-amine. InChIKey: VWWPIEZFOILENW-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)propan-2-amine |
| InChIKey | VWWPIEZFOILENW-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)F)Cl)N |
Computed by PubChem (NCBI)