Products 1304917-81-4
CAS 1304917-81-4 is the registry number for 5-Hydroxy-2-(1H-pyrrole-2-amido)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-hydroxy-2-(1H-pyrrole-2-carbonylamino)benzoic acid (CAS 1304917-81-4) is a chemical compound with the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. IUPAC name: 5-hydroxy-2-(1H-pyrrole-2-carbonylamino)benzoic acid. InChIKey: DESSDRVXUCGJQX-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O4 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 5-hydroxy-2-(1H-pyrrole-2-carbonylamino)benzoic acid |
| InChIKey | DESSDRVXUCGJQX-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C1)C(=O)NC2=C(C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)