Products 1305325-06-7
CAS 1305325-06-7 is the registry number for 2-(tert-Butyl)oxazolo[4,5-c]pyridine-7-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carbaldehyde (CAS 1305325-06-7) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carbaldehyde. InChIKey: KQVUYPFXMFZVRM-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridine-7-carbaldehyde |
| InChIKey | KQVUYPFXMFZVRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(O1)C(=CN=C2)C=O |
Computed by PubChem (NCBI)